CAS 2750928-44-8 is the registry number for 8-Vinylnaphthalen-1-amine, 98%. Offered by: AmBeed. Available pack sizes: 5g.
8-ethenylnaphthalen-1-amine (CAS 2750928-44-8) is a chemical compound with the molecular formula C12H11N and a molecular weight of 169.22 g/mol. IUPAC name: 8-ethenylnaphthalen-1-amine. InChIKey: BXUFHTLARJSZEQ-UHFFFAOYSA-N.
| Molecular formula | C12H11N |
|---|---|
| Molecular weight | 169.22 g/mol |
| IUPAC name | 8-ethenylnaphthalen-1-amine |
| InChIKey | BXUFHTLARJSZEQ-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=CC2=C1C(=CC=C2)N |
Computed by PubChem (NCBI)