CAS 2751298-48-1 is the registry number for 1-Chloro-3-nitrobenzene-13C6. Offered by: TRC. Available pack sizes: 50mg.
3-chloro-1-nitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (CAS 2751298-48-1) is a chemical compound with the molecular formula C6H4ClNO2 and a molecular weight of 163.51 g/mol. IUPAC name: 3-chloro-1-nitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene. InChIKey: KMAQZIILEGKYQZ-IDEBNGHGSA-N.
| Molecular formula | C6H4ClNO2 |
|---|---|
| Molecular weight | 163.51 g/mol |
| IUPAC name | 3-chloro-1-nitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| InChIKey | KMAQZIILEGKYQZ-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13CH][13C](=[13CH]1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)