CAS 2751302-41-5 is the registry number for N-(4-bromo-5-methyl-1,3-thiazol-2-yl)-2,2,2-trifluoroacetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-(4-bromo-5-methyl-1,3-thiazol-2-yl)-2,2,2-trifluoroacetamide (CAS 2751302-41-5) is a chemical compound with the molecular formula C6H4BrF3N2OS and a molecular weight of 289.08 g/mol. IUPAC name: N-(4-bromo-5-methyl-1,3-thiazol-2-yl)-2,2,2-trifluoroacetamide. InChIKey: IBDKKFCAPAWUQX-UHFFFAOYSA-N.
| Molecular formula | C6H4BrF3N2OS |
|---|---|
| Molecular weight | 289.08 g/mol |
| IUPAC name | N-(4-bromo-5-methyl-1,3-thiazol-2-yl)-2,2,2-trifluoroacetamide |
| InChIKey | IBDKKFCAPAWUQX-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)NC(=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)