CAS 2751530-13-7 is the registry number for Seladelpar sodium salt. Offered by: TargetMol. Available pack sizes: 500mg.
Sodium 2-[4-[(2R)-2-ethoxy-3-[4-(trifluoromethyl)phenoxy]propyl]sulfanyl-2-methylphenoxy]acetate (CAS 2751530-13-7) is a chemical compound with the molecular formula C21H22F3NaO5S and a molecular weight of 466.4 g/mol. IUPAC name: sodium 2-[4-[(2R)-2-ethoxy-3-[4-(trifluoromethyl)phenoxy]propyl]sulfanyl-2-methylphenoxy]acetate. InChIKey: XCAXFCPCOXDEHC-UNTBIKODSA-M.
| Molecular formula | C21H22F3NaO5S |
|---|---|
| Molecular weight | 466.4 g/mol |
| IUPAC name | sodium 2-[4-[(2R)-2-ethoxy-3-[4-(trifluoromethyl)phenoxy]propyl]sulfanyl-2-methylphenoxy]acetate |
| InChIKey | XCAXFCPCOXDEHC-UNTBIKODSA-M |
| SMILES | CCO[C@H](COC1=CC=C(C=C1)C(F)(F)F)CSC2=CC(=C(C=C2)OCC(=O)[O-])C.[Na+] |
Computed by PubChem (NCBI)