CAS 2751539-26-9 appears in our catalog under these names: Benzoisothiazol-3-one-13C6, >95% (HPLC), Benzisothiazolinone-13C6. Offered by: TRC, MedChemExpress. Available pack sizes: 0,5mg, 10mg, 1mg, 500 μg, 1 mg.
1,2-benzothiazol-3-one (CAS 2751539-26-9) is a chemical compound with the molecular formula C7H5NOS and a molecular weight of 157.14 g/mol. IUPAC name: 1,2-benzothiazol-3-one. InChIKey: DMSMPAJRVJJAGA-IDEBNGHGSA-N.
| Molecular formula | C7H5NOS |
|---|---|
| Molecular weight | 157.14 g/mol |
| IUPAC name | 1,2-benzothiazol-3-one |
| InChIKey | DMSMPAJRVJJAGA-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]2[13C](=[13CH]1)C(=O)NS2 |
Computed by PubChem (NCBI)