CAS 2751721-40-9 appears in our catalog under these names: AZ5576, 98%, AZ5576/ 100%, AZ5576, AZ5576 99%, AZ5576, 99.86%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
Cis-(1S,3R)-3-acetamido-N-[4-(4-fluoro-2-methoxyphenyl)-2-pyridinyl]cyclohexane-1-carboxamide (CAS 2751721-40-9) is a chemical compound with the molecular formula C21H24FN3O3 and a molecular weight of 385.4 g/mol. IUPAC name: cis-(1S,3R)-3-acetamido-N-[4-(4-fluoro-2-methoxyphenyl)-2-pyridinyl]cyclohexane-1-carboxamide. InChIKey: QNWXRLPZIFMTBK-DOTOQJQBSA-N.
| Molecular formula | C21H24FN3O3 |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | cis-(1S,3R)-3-acetamido-N-[4-(4-fluoro-2-methoxyphenyl)-2-pyridinyl]cyclohexane-1-carboxamide |
| InChIKey | QNWXRLPZIFMTBK-DOTOQJQBSA-N |
| SMILES | CC(=O)N[C@@H]1CCC[C@@H](C1)C(=O)NC2=NC=CC(=C2)C3=C(C=C(C=C3)F)OC |
Computed by PubChem (NCBI)