CAS 2751977-98-5 appears in our catalog under these names: 3,4–difluoro–N,N–didesmethyl U–47700 (trifluoroacetate salt), 3,4-Difluoro-N,N-didesmethyl U-47700 Trifluoroacetate, 3,4-Difluoro-N,N-didesmethyl U-47700 (TFA). Offered by: GLPBio, TRC, MedChemExpress. Available pack sizes: 5mg, 100mg, 1mg, 1 mg, 5 mg.
N-[(1R,2R)-2-aminocyclohexyl]-3,4-difluoro-N-methylbenzamide;2,2,2-trifluoroacetic acid (CAS 2751977-98-5) is a chemical compound with the molecular formula C16H19F5N2O3 and a molecular weight of 382.33 g/mol. IUPAC name: N-[(1R,2R)-2-aminocyclohexyl]-3,4-difluoro-N-methylbenzamide;2,2,2-trifluoroacetic acid. InChIKey: ISOLRPIQMDXRQD-OJERSXHUSA-N.
| Molecular formula | C16H19F5N2O3 |
|---|---|
| Molecular weight | 382.33 g/mol |
| IUPAC name | N-[(1R,2R)-2-aminocyclohexyl]-3,4-difluoro-N-methylbenzamide;2,2,2-trifluoroacetic acid |
| InChIKey | ISOLRPIQMDXRQD-OJERSXHUSA-N |
| SMILES | CN([C@@H]1CCCC[C@H]1N)C(=O)C2=CC(=C(C=C2)F)F.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)