Products 2752453-58-8
CAS 2752453-58-8 is the registry number for Metallo-β-lactamase-IN-7. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(2-amino-1,3-benzothiazol-6-yl)methyl]imidazole-2-carboxylic acid (CAS 2752453-58-8) is a chemical compound with the molecular formula C12H10N4O2S and a molecular weight of 274.30 g/mol. IUPAC name: 1-[(2-amino-1,3-benzothiazol-6-yl)methyl]imidazole-2-carboxylic acid. InChIKey: AKDVYGWISHGCBY-UHFFFAOYSA-N.
| Molecular formula | C12H10N4O2S |
|---|---|
| Molecular weight | 274.30 g/mol |
| IUPAC name | 1-[(2-amino-1,3-benzothiazol-6-yl)methyl]imidazole-2-carboxylic acid |
| InChIKey | AKDVYGWISHGCBY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CN3C=CN=C3C(=O)O)SC(=N2)N |
Computed by PubChem (NCBI)