CAS 2752475-06-0 is the registry number for Ethyl-2-methylsulfonylphenothiazine-10-Carboxylate. Offered by: TRC. Available pack sizes: 500mg, 50mg.
Ethyl 2-methylsulfonylphenothiazine-10-carboxylate (CAS 2752475-06-0) is a chemical compound with the molecular formula C16H15NO4S2 and a molecular weight of 349.4 g/mol. IUPAC name: ethyl 2-methylsulfonylphenothiazine-10-carboxylate. InChIKey: RHQMWDVFDXEODM-UHFFFAOYSA-N.
| Molecular formula | C16H15NO4S2 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | ethyl 2-methylsulfonylphenothiazine-10-carboxylate |
| InChIKey | RHQMWDVFDXEODM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1C2=CC=CC=C2SC3=C1C=C(C=C3)S(=O)(=O)C |
Computed by PubChem (NCBI)