Products 27530-02-5
CAS 27530-02-5 is the registry number for Valylleucine (TFA), 99.25%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 5 mg, 25 mg, 50 mg, 10 mg.
(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-4-methylpentanoic acid;2,2,2-trifluoroacetic acid (CAS 27530-02-5) is a chemical compound with the molecular formula C13H23F3N2O5 and a molecular weight of 344.33 g/mol. IUPAC name: (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-4-methylpentanoic acid;2,2,2-trifluoroacetic acid. InChIKey: RWSRFNOLHXWYRF-OZZZDHQUSA-N.
| Molecular formula | C13H23F3N2O5 |
|---|---|
| Molecular weight | 344.33 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-4-methylpentanoic acid;2,2,2-trifluoroacetic acid |
| InChIKey | RWSRFNOLHXWYRF-OZZZDHQUSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)[C@H](C(C)C)N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)
Synonyms:
Valylleucine (TFA), orb3023030