CAS 275366-32-0 appears in our catalog under these names: H–Lys–Ser–OH · HCl, H-Lys-Ser-OH·HCl. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 5g, 1000mg, 2000mg, 5000mg.
(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-hydroxypropanoic acid;hydrochloride (CAS 275366-32-0) is a chemical compound with the molecular formula C9H20ClN3O4 and a molecular weight of 269.72 g/mol. IUPAC name: (2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-hydroxypropanoic acid;hydrochloride. InChIKey: VXTTUQHCQLGDHE-LEUCUCNGSA-N.
| Molecular formula | C9H20ClN3O4 |
|---|---|
| Molecular weight | 269.72 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-hydroxypropanoic acid;hydrochloride |
| InChIKey | VXTTUQHCQLGDHE-LEUCUCNGSA-N |
| SMILES | C(CCN)C[C@@H](C(=O)N[C@@H](CO)C(=O)O)N.Cl |
Computed by PubChem (NCBI)