CAS 275385-03-0 appears in our catalog under these names: N-Boc-n-bis(peg1-oh), 95%, N–Boc–N–bis(PEG2–OH), tert-Butyl bis(2-(2-hydroxyethoxy)ethyl)carbamate, 97%, 97%, N-Boc-N-bis(PEG2-OH), 97.0%, N-Boc-N-bis(PEG2-OH), 97%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 100 mg, 250 mg, 1 g.
Tert-butyl N,N-bis[2-(2-hydroxyethoxy)ethyl]carbamate (CAS 275385-03-0) is a chemical compound with the molecular formula C13H27NO6 and a molecular weight of 293.36 g/mol. IUPAC name: tert-butyl N,N-bis[2-(2-hydroxyethoxy)ethyl]carbamate. InChIKey: QKKAOQUTADWQAZ-UHFFFAOYSA-N.
| Molecular formula | C13H27NO6 |
|---|---|
| Molecular weight | 293.36 g/mol |
| IUPAC name | tert-butyl N,N-bis[2-(2-hydroxyethoxy)ethyl]carbamate |
| InChIKey | QKKAOQUTADWQAZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CCOCCO)CCOCCO |
Computed by PubChem (NCBI)