CAS 2754283-55-9 is the registry number for NCX1-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]-7-nitro-5-phenyl-3H-1,4-benzodiazepin-2-one (CAS 2754283-55-9) is a chemical compound with the molecular formula C23H24N4O4 and a molecular weight of 420.5 g/mol. IUPAC name: 1-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]-7-nitro-5-phenyl-3H-1,4-benzodiazepin-2-one. InChIKey: KRZAOSOPWPCGLI-UHFFFAOYSA-N.
| Molecular formula | C23H24N4O4 |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | 1-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]-7-nitro-5-phenyl-3H-1,4-benzodiazepin-2-one |
| InChIKey | KRZAOSOPWPCGLI-UHFFFAOYSA-N |
| SMILES | CC1CCCCN1C(=O)CN2C(=O)CN=C(C3=C2C=CC(=C3)[N+](=O)[O-])C4=CC=CC=C4 |
Computed by PubChem (NCBI)