Products 2754355-09-2
CAS 2754355-09-2 is the registry number for 4-(N-tert-Butoxycarbonylamino)piperidine-D4. Offered by: TRC. Available pack sizes: 1g.
Tert-butyl N-(3,3,5,5-tetradeuteriopiperidin-4-yl)carbamate (CAS 2754355-09-2) is a chemical compound with the molecular formula C10H20N2O2 and a molecular weight of 204.30 g/mol. IUPAC name: tert-butyl N-(3,3,5,5-tetradeuteriopiperidin-4-yl)carbamate. InChIKey: CKXZPVPIDOJLLM-CQOLUAMGSA-N.
| Molecular formula | C10H20N2O2 |
|---|---|
| Molecular weight | 204.30 g/mol |
| IUPAC name | tert-butyl N-(3,3,5,5-tetradeuteriopiperidin-4-yl)carbamate |
| InChIKey | CKXZPVPIDOJLLM-CQOLUAMGSA-N |
| SMILES | [2H]C1(CNCC(C1NC(=O)OC(C)(C)C)([2H])[2H])[2H] |
Computed by PubChem (NCBI)