Products 2755402-00-5
CAS 2755402-00-5 is the registry number for 5-Fluoro-3-(trifluoromethyl)-1,5,6,7-tetrahydro-4H-indol-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-fluoro-3-(trifluoromethyl)-1,5,6,7-tetrahydroindol-4-one (CAS 2755402-00-5) is a chemical compound with the molecular formula C9H7F4NO and a molecular weight of 221.15 g/mol. IUPAC name: 5-fluoro-3-(trifluoromethyl)-1,5,6,7-tetrahydroindol-4-one. InChIKey: URSMCGHEFBTVNT-UHFFFAOYSA-N.
| Molecular formula | C9H7F4NO |
|---|---|
| Molecular weight | 221.15 g/mol |
| IUPAC name | 5-fluoro-3-(trifluoromethyl)-1,5,6,7-tetrahydroindol-4-one |
| InChIKey | URSMCGHEFBTVNT-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CN2)C(F)(F)F)C(=O)C1F |
Computed by PubChem (NCBI)