Products 2755453-99-5
CAS 2755453-99-5 is the registry number for (R)-1-(benzofuran-5-yl)-N-methylpropan-2-amine hydrochloride. Offered by: TRC. Available pack sizes: 750mg.
(2R)-1-(1-benzofuran-5-yl)-N-methylpropan-2-amine;hydrochloride (CAS 2755453-99-5) is a chemical compound with the molecular formula C12H16ClNO and a molecular weight of 225.71 g/mol. IUPAC name: (2R)-1-(1-benzofuran-5-yl)-N-methylpropan-2-amine;hydrochloride. InChIKey: KDOMNGVEAOZFQY-SBSPUUFOSA-N.
| Molecular formula | C12H16ClNO |
|---|---|
| Molecular weight | 225.71 g/mol |
| IUPAC name | (2R)-1-(1-benzofuran-5-yl)-N-methylpropan-2-amine;hydrochloride |
| InChIKey | KDOMNGVEAOZFQY-SBSPUUFOSA-N |
| SMILES | C[C@H](CC1=CC2=C(C=C1)OC=C2)NC.Cl |
Computed by PubChem (NCBI)