Products 2755716-83-5
CAS 2755716-83-5 is the registry number for 2,2-Dichloro-1-(4-methoxy-2,6-dimethylphenyl)ethanol, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2,2-dichloro-1-(4-methoxy-2,6-dimethylphenyl)ethanol (CAS 2755716-83-5) is a chemical compound with the molecular formula C11H14Cl2O2 and a molecular weight of 249.13 g/mol. IUPAC name: 2,2-dichloro-1-(4-methoxy-2,6-dimethylphenyl)ethanol. InChIKey: WZINNDPUCXFYMB-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2O2 |
|---|---|
| Molecular weight | 249.13 g/mol |
| IUPAC name | 2,2-dichloro-1-(4-methoxy-2,6-dimethylphenyl)ethanol |
| InChIKey | WZINNDPUCXFYMB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(C(Cl)Cl)O)C)OC |
Computed by PubChem (NCBI)