Products 2755717-90-7
CAS 2755717-90-7 is the registry number for Ethyl 3-(4-bromo-2-(trifluoromethyl)phenyl)-3-hydroxypropanoate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
Ethyl 3-[4-bromo-2-(trifluoromethyl)phenyl]-3-hydroxypropanoate (CAS 2755717-90-7) is a chemical compound with the molecular formula C12H12BrF3O3 and a molecular weight of 341.12 g/mol. IUPAC name: ethyl 3-[4-bromo-2-(trifluoromethyl)phenyl]-3-hydroxypropanoate. InChIKey: YRLSRVCEALAHJF-UHFFFAOYSA-N.
| Molecular formula | C12H12BrF3O3 |
|---|---|
| Molecular weight | 341.12 g/mol |
| IUPAC name | ethyl 3-[4-bromo-2-(trifluoromethyl)phenyl]-3-hydroxypropanoate |
| InChIKey | YRLSRVCEALAHJF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C1=C(C=C(C=C1)Br)C(F)(F)F)O |
Computed by PubChem (NCBI)