CAS 2755719-03-8 is the registry number for 1-(3-Bromo-5-fluoro-2-methoxyphenyl)-2,2-dichloroethanol, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-(3-bromo-5-fluoro-2-methoxyphenyl)-2,2-dichloroethanol (CAS 2755719-03-8) is a chemical compound with the molecular formula C9H8BrCl2FO2 and a molecular weight of 317.96 g/mol. IUPAC name: 1-(3-bromo-5-fluoro-2-methoxyphenyl)-2,2-dichloroethanol. InChIKey: WEMPHLAWCBCHEW-UHFFFAOYSA-N.
| Molecular formula | C9H8BrCl2FO2 |
|---|---|
| Molecular weight | 317.96 g/mol |
| IUPAC name | 1-(3-bromo-5-fluoro-2-methoxyphenyl)-2,2-dichloroethanol |
| InChIKey | WEMPHLAWCBCHEW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Br)F)C(C(Cl)Cl)O |
Computed by PubChem (NCBI)