Products 2755719-11-8
CAS 2755719-11-8 is the registry number for 2,2-Dichloro-1-(4-fluoro-2,6-dimethylphenyl)ethanol, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2,2-dichloro-1-(4-fluoro-2,6-dimethylphenyl)ethanol (CAS 2755719-11-8) is a chemical compound with the molecular formula C10H11Cl2FO and a molecular weight of 237.09 g/mol. IUPAC name: 2,2-dichloro-1-(4-fluoro-2,6-dimethylphenyl)ethanol. InChIKey: QUDVJKQYPHYSPN-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2FO |
|---|---|
| Molecular weight | 237.09 g/mol |
| IUPAC name | 2,2-dichloro-1-(4-fluoro-2,6-dimethylphenyl)ethanol |
| InChIKey | QUDVJKQYPHYSPN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(C(Cl)Cl)O)C)F |
Computed by PubChem (NCBI)