CAS 2755721-62-9 is the registry number for 3-Chloro-4-fluoro-5-(methylthio)benzaldehyde, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
3-chloro-4-fluoro-5-methylsulfanylbenzaldehyde (CAS 2755721-62-9) is a chemical compound with the molecular formula C8H6ClFOS and a molecular weight of 204.65 g/mol. IUPAC name: 3-chloro-4-fluoro-5-methylsulfanylbenzaldehyde. InChIKey: SJHMKOLBZHTHIV-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFOS |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | 3-chloro-4-fluoro-5-methylsulfanylbenzaldehyde |
| InChIKey | SJHMKOLBZHTHIV-UHFFFAOYSA-N |
| SMILES | CSC1=C(C(=CC(=C1)C=O)Cl)F |
Computed by PubChem (NCBI)