CAS 2755723-99-8 is the registry number for 2,2-Dichloro-1-(3,5-dibromophenyl)ethanol, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2,2-dichloro-1-(3,5-dibromophenyl)ethanol (CAS 2755723-99-8) is a chemical compound with the molecular formula C8H6Br2Cl2O and a molecular weight of 348.84 g/mol. IUPAC name: 2,2-dichloro-1-(3,5-dibromophenyl)ethanol. InChIKey: YDIDEIYHHZYDTH-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2Cl2O |
|---|---|
| Molecular weight | 348.84 g/mol |
| IUPAC name | 2,2-dichloro-1-(3,5-dibromophenyl)ethanol |
| InChIKey | YDIDEIYHHZYDTH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Br)Br)C(C(Cl)Cl)O |
Computed by PubChem (NCBI)