Products 2755724-35-5
CAS 2755724-35-5 is the registry number for 2,2-Dichloro-1-(3-fluoro-2-methoxyphenyl)ethanol, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2,2-dichloro-1-(3-fluoro-2-methoxyphenyl)ethanol (CAS 2755724-35-5) is a chemical compound with the molecular formula C9H9Cl2FO2 and a molecular weight of 239.07 g/mol. IUPAC name: 2,2-dichloro-1-(3-fluoro-2-methoxyphenyl)ethanol. InChIKey: QYQWUSLFISOODQ-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2FO2 |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 2,2-dichloro-1-(3-fluoro-2-methoxyphenyl)ethanol |
| InChIKey | QYQWUSLFISOODQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC=C1F)C(C(Cl)Cl)O |
Computed by PubChem (NCBI)