Products 2755782-91-1
CAS 2755782-91-1 is the registry number for Di-tert-butyl (1S,3aR,4S,7R,7aS)-1,3,3a,4,7,7a-hexahydro-2H-4,7-methanoisoindole-1,2-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ditert-butyl (1R,2S,3S,6R,7S)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,4-dicarboxylate (CAS 2755782-91-1) is a chemical compound with the molecular formula C19H29NO4 and a molecular weight of 335.4 g/mol. IUPAC name: ditert-butyl (1R,2S,3S,6R,7S)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,4-dicarboxylate. InChIKey: NMEMFMBXYHFVSU-SEBNEYGDSA-N.
| Molecular formula | C19H29NO4 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | ditert-butyl (1R,2S,3S,6R,7S)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,4-dicarboxylate |
| InChIKey | NMEMFMBXYHFVSU-SEBNEYGDSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1[C@H]2[C@@H]3C[C@H]([C@H]2CN1C(=O)OC(C)(C)C)C=C3 |
Computed by PubChem (NCBI)