Products 1076199-24-0

CAS 1076199-24-0 is the registry number for N-Boc N,O-Didesmethylvenlafaxine. Offered by: TRC. Available pack sizes: 50mg, 5mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[2-(1-hydroxycyclohexyl)-2-(4-hydroxyphenyl)ethyl]carbamate (CAS 1076199-24-0) is a chemical compound with the molecular formula C19H29NO4 and a molecular weight of 335.4 g/mol. IUPAC name: tert-butyl N-[2-(1-hydroxycyclohexyl)-2-(4-hydroxyphenyl)ethyl]carbamate. InChIKey: AGTIUSJAKDOMBF-UHFFFAOYSA-N.

Identity
Molecular formulaC19H29NO4
Molecular weight335.4 g/mol
IUPAC nametert-butyl N-[2-(1-hydroxycyclohexyl)-2-(4-hydroxyphenyl)ethyl]carbamate
InChIKeyAGTIUSJAKDOMBF-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCC(C1=CC=C(C=C1)O)C2(CCCCC2)O

Computed by PubChem (NCBI)