CAS 2755908-48-4 is the registry number for Losartan Impurity 29. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-[[5-(azidomethyl)-2-butyl-4-chloroimidazol-1-yl]methyl]phenyl]benzonitrile (CAS 2755908-48-4) is a chemical compound with the molecular formula C22H21ClN6 and a molecular weight of 404.9 g/mol. IUPAC name: 2-[4-[[5-(azidomethyl)-2-butyl-4-chloroimidazol-1-yl]methyl]phenyl]benzonitrile. InChIKey: ZFSXKEVISUTRLW-UHFFFAOYSA-N.
| Molecular formula | C22H21ClN6 |
|---|---|
| Molecular weight | 404.9 g/mol |
| IUPAC name | 2-[4-[[5-(azidomethyl)-2-butyl-4-chloroimidazol-1-yl]methyl]phenyl]benzonitrile |
| InChIKey | ZFSXKEVISUTRLW-UHFFFAOYSA-N |
| SMILES | CCCCC1=NC(=C(N1CC2=CC=C(C=C2)C3=CC=CC=C3C#N)CN=[N+]=[N-])Cl |
Computed by PubChem (NCBI)