Products 2755930-28-8
CAS 2755930-28-8 is the registry number for Antileishmanial agent-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethyl 2-[4-[(3-chloro-6-nitroindazol-1-yl)methyl]triazol-1-yl]acetate (CAS 2755930-28-8) is a chemical compound with the molecular formula C14H13ClN6O4 and a molecular weight of 364.74 g/mol. IUPAC name: ethyl 2-[4-[(3-chloro-6-nitroindazol-1-yl)methyl]triazol-1-yl]acetate. InChIKey: MCCHNZYSPZWPTF-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN6O4 |
|---|---|
| Molecular weight | 364.74 g/mol |
| IUPAC name | ethyl 2-[4-[(3-chloro-6-nitroindazol-1-yl)methyl]triazol-1-yl]acetate |
| InChIKey | MCCHNZYSPZWPTF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1C=C(N=N1)CN2C3=C(C=CC(=C3)[N+](=O)[O-])C(=N2)Cl |
Computed by PubChem (NCBI)
Synonyms:
Antileishmanial agent-3, orb1688645