CAS 2755951-50-7 is the registry number for Methyl (2S)-2-amino-3-(5,5-dimethyl-2-oxopyrrolidin-3-yl)propanoate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2-amino-3-(5,5-dimethyl-2-oxopyrrolidin-3-yl)propanoate;hydrochloride (CAS 2755951-50-7) is a chemical compound with the molecular formula C10H19ClN2O3 and a molecular weight of 250.72 g/mol. IUPAC name: methyl (2S)-2-amino-3-(5,5-dimethyl-2-oxopyrrolidin-3-yl)propanoate;hydrochloride. InChIKey: YSUPRYMYIIPMNF-JWOPXBRZSA-N.
| Molecular formula | C10H19ClN2O3 |
|---|---|
| Molecular weight | 250.72 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(5,5-dimethyl-2-oxopyrrolidin-3-yl)propanoate;hydrochloride |
| InChIKey | YSUPRYMYIIPMNF-JWOPXBRZSA-N |
| SMILES | CC1(CC(C(=O)N1)C[C@@H](C(=O)OC)N)C.Cl |
Computed by PubChem (NCBI)