Products 105931-64-4
CAS 105931-64-4 appears in our catalog under these names: H-Val-pro-oh hydrochloride, 95%, H-Val-Pro-OH.HCl, 95+%, H–Val–Pro–OH · HCl. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 250mg, 5g, 50mg, 1g.
(2S)-1-[(2S)-2-amino-3-methylbutanoyl]pyrrolidine-2-carboxylic acid;hydrochloride (CAS 105931-64-4) is a chemical compound with the molecular formula C10H19ClN2O3 and a molecular weight of 250.72 g/mol. IUPAC name: (2S)-1-[(2S)-2-amino-3-methylbutanoyl]pyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: IIQAHNBGJJXSGP-WSZWBAFRSA-N.
| Molecular formula | C10H19ClN2O3 |
|---|---|
| Molecular weight | 250.72 g/mol |
| IUPAC name | (2S)-1-[(2S)-2-amino-3-methylbutanoyl]pyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | IIQAHNBGJJXSGP-WSZWBAFRSA-N |
| SMILES | CC(C)[C@@H](C(=O)N1CCC[C@H]1C(=O)O)N.Cl |
Computed by PubChem (NCBI)