Products 2755951-93-8
CAS 2755951-93-8 is the registry number for (S)-2-Amino-3-((S)-2-oxopiperidin-3-yl)propanamide hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-3-[(3S)-2-oxopiperidin-3-yl]propanamide;hydrochloride (CAS 2755951-93-8) is a chemical compound with the molecular formula C8H16ClN3O2 and a molecular weight of 221.68 g/mol. IUPAC name: (2S)-2-amino-3-[(3S)-2-oxopiperidin-3-yl]propanamide;hydrochloride. InChIKey: RWRQJCPJOZOJNG-GEMLJDPKSA-N.
| Molecular formula | C8H16ClN3O2 |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | (2S)-2-amino-3-[(3S)-2-oxopiperidin-3-yl]propanamide;hydrochloride |
| InChIKey | RWRQJCPJOZOJNG-GEMLJDPKSA-N |
| SMILES | C1C[C@H](C(=O)NC1)C[C@@H](C(=O)N)N.Cl |
Computed by PubChem (NCBI)