Products 2755986-33-3
CAS 2755986-33-3 is the registry number for AChE-IN-69. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[4-(trifluoromethyl)phenyl]-6-thia-1,4,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one (CAS 2755986-33-3) is a chemical compound with the molecular formula C16H12F3N3OS and a molecular weight of 351.3 g/mol. IUPAC name: 5-[4-(trifluoromethyl)phenyl]-6-thia-1,4,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one. InChIKey: FAJBNOKBPQRKGO-UHFFFAOYSA-N.
| Molecular formula | C16H12F3N3OS |
|---|---|
| Molecular weight | 351.3 g/mol |
| IUPAC name | 5-[4-(trifluoromethyl)phenyl]-6-thia-1,4,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one |
| InChIKey | FAJBNOKBPQRKGO-UHFFFAOYSA-N |
| SMILES | C1CCN2C(=NC3=C(C2=O)N=C(S3)C4=CC=C(C=C4)C(F)(F)F)C1 |
Computed by PubChem (NCBI)
Synonyms:
AChE-IN-69, orb2664438