CAS 2756104-02-4 is the registry number for tert-butyl (3S)-3-(methoxymethyl)pyrrolidine-1-carboxylate, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl (3S)-3-(methoxymethyl)pyrrolidine-1-carboxylate (CAS 2756104-02-4) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl (3S)-3-(methoxymethyl)pyrrolidine-1-carboxylate. InChIKey: UQKCRLKIAGDYAD-VIFPVBQESA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl (3S)-3-(methoxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | UQKCRLKIAGDYAD-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C1)COC |
Computed by PubChem (NCBI)