Products 2756181-04-9

CAS 2756181-04-9 is the registry number for 4-Bromo-3-hydroxy-2-nitrophenoxyacetic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(4-bromo-3-hydroxy-2-nitrophenoxy)acetic acid (CAS 2756181-04-9) is a chemical compound with the molecular formula C8H6BrNO6 and a molecular weight of 292.04 g/mol. IUPAC name: 2-(4-bromo-3-hydroxy-2-nitrophenoxy)acetic acid. InChIKey: KQHSFTQKBYFOTA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrNO6
Molecular weight292.04 g/mol
IUPAC name2-(4-bromo-3-hydroxy-2-nitrophenoxy)acetic acid
InChIKeyKQHSFTQKBYFOTA-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1OCC(=O)O)[N+](=O)[O-])O)Br

Computed by PubChem (NCBI)