CAS 2756197-66-5 is the registry number for Ethyl 3-(2-fluoro-6-nitrophenyl)prop-2-enoate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl (E)-3-(2-fluoro-6-nitrophenyl)prop-2-enoate (CAS 2756197-66-5) is a chemical compound with the molecular formula C11H10FNO4 and a molecular weight of 239.20 g/mol. IUPAC name: ethyl (E)-3-(2-fluoro-6-nitrophenyl)prop-2-enoate. InChIKey: JBMQFFJRRCRZEF-VOTSOKGWSA-N.
| Molecular formula | C11H10FNO4 |
|---|---|
| Molecular weight | 239.20 g/mol |
| IUPAC name | ethyl (E)-3-(2-fluoro-6-nitrophenyl)prop-2-enoate |
| InChIKey | JBMQFFJRRCRZEF-VOTSOKGWSA-N |
| SMILES | CCOC(=O)/C=C/C1=C(C=CC=C1F)[N+](=O)[O-] |
Computed by PubChem (NCBI)