CAS 2756197-67-6 is the registry number for (E)-1-[(4-Bromo-2,6-difluorophenyl)methylidene]-2-methylhydrazine, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
N-[(E)-(4-bromo-2,6-difluorophenyl)methylideneamino]methanamine (CAS 2756197-67-6) is a chemical compound with the molecular formula C8H7BrF2N2 and a molecular weight of 249.06 g/mol. IUPAC name: N-[(E)-(4-bromo-2,6-difluorophenyl)methylideneamino]methanamine. InChIKey: LFCFESVYCPKGHZ-YIXHJXPBSA-N.
| Molecular formula | C8H7BrF2N2 |
|---|---|
| Molecular weight | 249.06 g/mol |
| IUPAC name | N-[(E)-(4-bromo-2,6-difluorophenyl)methylideneamino]methanamine |
| InChIKey | LFCFESVYCPKGHZ-YIXHJXPBSA-N |
| SMILES | CN/N=C/C1=C(C=C(C=C1F)Br)F |
Computed by PubChem (NCBI)