CAS 2756317-62-9 is the registry number for 1-(6-Iodo-1-methyl-1H-indazol-3-yl)dihydropyrimidine-2,4(1H,3H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(6-iodo-1-methylindazol-3-yl)-1,3-diazinane-2,4-dione (CAS 2756317-62-9) is a chemical compound with the molecular formula C12H11IN4O2 and a molecular weight of 370.15 g/mol. IUPAC name: 1-(6-iodo-1-methylindazol-3-yl)-1,3-diazinane-2,4-dione. InChIKey: MTJBHNSLRCJJHQ-UHFFFAOYSA-N.
| Molecular formula | C12H11IN4O2 |
|---|---|
| Molecular weight | 370.15 g/mol |
| IUPAC name | 1-(6-iodo-1-methylindazol-3-yl)-1,3-diazinane-2,4-dione |
| InChIKey | MTJBHNSLRCJJHQ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)I)C(=N1)N3CCC(=O)NC3=O |
Computed by PubChem (NCBI)