Products 2756334-31-1
CAS 2756334-31-1 is the registry number for 7-bromo-3-ethyl-8-fluoro-1H-quinoxalin-2-one, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 500mg.
7-bromo-3-ethyl-8-fluoro-1H-quinoxalin-2-one (CAS 2756334-31-1) is a chemical compound with the molecular formula C10H8BrFN2O and a molecular weight of 271.09 g/mol. IUPAC name: 7-bromo-3-ethyl-8-fluoro-1H-quinoxalin-2-one. InChIKey: KIJFQWHEZAQWPL-UHFFFAOYSA-N.
| Molecular formula | C10H8BrFN2O |
|---|---|
| Molecular weight | 271.09 g/mol |
| IUPAC name | 7-bromo-3-ethyl-8-fluoro-1H-quinoxalin-2-one |
| InChIKey | KIJFQWHEZAQWPL-UHFFFAOYSA-N |
| SMILES | CCC1=NC2=C(C(=C(C=C2)Br)F)NC1=O |
Computed by PubChem (NCBI)