Products 2756363-28-5
CAS 2756363-28-5 is the registry number for (5-Bromo-3-(hydroxy(phenyl)methyl)-1H-indol-2-yl)diphenylmethanol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[5-bromo-3-[hydroxy(phenyl)methyl]-1H-indol-2-yl]-diphenylmethanol (CAS 2756363-28-5) is a chemical compound with the molecular formula C28H22BrNO2 and a molecular weight of 484.4 g/mol. IUPAC name: [5-bromo-3-[hydroxy(phenyl)methyl]-1H-indol-2-yl]-diphenylmethanol. InChIKey: BZVSMBKWVIZKCP-UHFFFAOYSA-N.
| Molecular formula | C28H22BrNO2 |
|---|---|
| Molecular weight | 484.4 g/mol |
| IUPAC name | [5-bromo-3-[hydroxy(phenyl)methyl]-1H-indol-2-yl]-diphenylmethanol |
| InChIKey | BZVSMBKWVIZKCP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=C(NC3=C2C=C(C=C3)Br)C(C4=CC=CC=C4)(C5=CC=CC=C5)O)O |
Computed by PubChem (NCBI)