Products 2756363-31-0
CAS 2756363-31-0 is the registry number for (3-(Hydroxy(phenyl)methyl)-6-methoxy-1H-indol-2-yl)diphenylmethanol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[3-[hydroxy(phenyl)methyl]-6-methoxy-1H-indol-2-yl]-diphenylmethanol (CAS 2756363-31-0) is a chemical compound with the molecular formula C29H25NO3 and a molecular weight of 435.5 g/mol. IUPAC name: [3-[hydroxy(phenyl)methyl]-6-methoxy-1H-indol-2-yl]-diphenylmethanol. InChIKey: WKENETCXFURWQA-UHFFFAOYSA-N.
| Molecular formula | C29H25NO3 |
|---|---|
| Molecular weight | 435.5 g/mol |
| IUPAC name | [3-[hydroxy(phenyl)methyl]-6-methoxy-1H-indol-2-yl]-diphenylmethanol |
| InChIKey | WKENETCXFURWQA-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=C(N2)C(C3=CC=CC=C3)(C4=CC=CC=C4)O)C(C5=CC=CC=C5)O |
Computed by PubChem (NCBI)