CAS 2756367-30-1 is the registry number for 1-(tert-Butyl) 3-methyl 5-(2-fluorophenyl)-4-hydroxy-1H-pyrrole-1,3-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-tert-butyl 3-O-methyl 5-(2-fluorophenyl)-4-hydroxypyrrole-1,3-dicarboxylate (CAS 2756367-30-1) is a chemical compound with the molecular formula C17H18FNO5 and a molecular weight of 335.33 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 5-(2-fluorophenyl)-4-hydroxypyrrole-1,3-dicarboxylate. InChIKey: SZLUKAPNRMXZNZ-UHFFFAOYSA-N.
| Molecular formula | C17H18FNO5 |
|---|---|
| Molecular weight | 335.33 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl 5-(2-fluorophenyl)-4-hydroxypyrrole-1,3-dicarboxylate |
| InChIKey | SZLUKAPNRMXZNZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C(=C1C2=CC=CC=C2F)O)C(=O)OC |
Computed by PubChem (NCBI)