CAS 2756410-83-8 is the registry number for MIF-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[3-methoxy-4-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)carbamoyl]phenyl]piperidine-3-carboxylic acid (CAS 2756410-83-8) is a chemical compound with the molecular formula C20H20N4O5S and a molecular weight of 428.5 g/mol. IUPAC name: 1-[3-methoxy-4-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)carbamoyl]phenyl]piperidine-3-carboxylic acid. InChIKey: DDYQIVGQBXREES-UHFFFAOYSA-N.
| Molecular formula | C20H20N4O5S |
|---|---|
| Molecular weight | 428.5 g/mol |
| IUPAC name | 1-[3-methoxy-4-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)carbamoyl]phenyl]piperidine-3-carboxylic acid |
| InChIKey | DDYQIVGQBXREES-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N2CCCC(C2)C(=O)O)C(=O)NC3=NN=C(O3)C4=CC=CS4 |
Computed by PubChem (NCBI)