CAS 2756652-47-6 is the registry number for 1-Benzyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-benzyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (CAS 2756652-47-6) is a chemical compound with the molecular formula C20H23BN2O2 and a molecular weight of 334.2 g/mol. IUPAC name: 1-benzyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole. InChIKey: YTBHYJXUIYVTEI-UHFFFAOYSA-N.
| Molecular formula | C20H23BN2O2 |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | 1-benzyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| InChIKey | YTBHYJXUIYVTEI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C=NN3CC4=CC=CC=C4 |
Computed by PubChem (NCBI)