Products 2756654-70-1
CAS 2756654-70-1 is the registry number for 8-Bromo-1,2-dihydro-3H-benzo[e]isoindol-3-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-1,2-dihydrobenzo[e]isoindol-3-one (CAS 2756654-70-1) is a chemical compound with the molecular formula C12H8BrNO and a molecular weight of 262.10 g/mol. IUPAC name: 8-bromo-1,2-dihydrobenzo[e]isoindol-3-one. InChIKey: HABSDYJSDOWHGZ-UHFFFAOYSA-N.
| Molecular formula | C12H8BrNO |
|---|---|
| Molecular weight | 262.10 g/mol |
| IUPAC name | 8-bromo-1,2-dihydrobenzo[e]isoindol-3-one |
| InChIKey | HABSDYJSDOWHGZ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC3=C2C=C(C=C3)Br)C(=O)N1 |
Computed by PubChem (NCBI)