CAS 2756657-93-7 is the registry number for 4-Bromo-3-oxo-2,3-dihydro-1H-indazole-5-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-3-oxo-1,2-dihydroindazole-5-carbonitrile (CAS 2756657-93-7) is a chemical compound with the molecular formula C8H4BrN3O and a molecular weight of 238.04 g/mol. IUPAC name: 4-bromo-3-oxo-1,2-dihydroindazole-5-carbonitrile. InChIKey: CQJFVYNOUZNHHB-UHFFFAOYSA-N.
| Molecular formula | C8H4BrN3O |
|---|---|
| Molecular weight | 238.04 g/mol |
| IUPAC name | 4-bromo-3-oxo-1,2-dihydroindazole-5-carbonitrile |
| InChIKey | CQJFVYNOUZNHHB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1C#N)Br)C(=O)NN2 |
Computed by PubChem (NCBI)