CAS 2756657-94-8 is the registry number for 4-Bromo-3-oxo-1-trityl-2,3-dihydro-1H-indazole-5-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-3-oxo-1-trityl-2H-indazole-5-carbonitrile (CAS 2756657-94-8) is a chemical compound with the molecular formula C27H18BrN3O and a molecular weight of 480.4 g/mol. IUPAC name: 4-bromo-3-oxo-1-trityl-2H-indazole-5-carbonitrile. InChIKey: ZUVBCQGDMUQENF-UHFFFAOYSA-N.
| Molecular formula | C27H18BrN3O |
|---|---|
| Molecular weight | 480.4 g/mol |
| IUPAC name | 4-bromo-3-oxo-1-trityl-2H-indazole-5-carbonitrile |
| InChIKey | ZUVBCQGDMUQENF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C5=C(C(=C(C=C5)C#N)Br)C(=O)N4 |
Computed by PubChem (NCBI)