Products 2757083-70-6
CAS 2757083-70-6 is the registry number for (R)-4-Isopropyl-2-(2-(methylthio)phenyl)-4,5-dihydrooxazole, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4R)-2-(2-methylsulfanylphenyl)-4-propan-2-yl-4,5-dihydro-1,3-oxazole (CAS 2757083-70-6) is a chemical compound with the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. IUPAC name: (4R)-2-(2-methylsulfanylphenyl)-4-propan-2-yl-4,5-dihydro-1,3-oxazole. InChIKey: NVZYGPIYRJYJNG-NSHDSACASA-N.
| Molecular formula | C13H17NOS |
|---|---|
| Molecular weight | 235.35 g/mol |
| IUPAC name | (4R)-2-(2-methylsulfanylphenyl)-4-propan-2-yl-4,5-dihydro-1,3-oxazole |
| InChIKey | NVZYGPIYRJYJNG-NSHDSACASA-N |
| SMILES | CC(C)[C@@H]1COC(=N1)C2=CC=CC=C2SC |
Computed by PubChem (NCBI)