CAS 2757097-20-2 is the registry number for 7-Bromo-4,6-dichloro-8-fluoro-2-(methylthio)quinazoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-4,6-dichloro-8-fluoro-2-methylsulfanylquinazoline (CAS 2757097-20-2) is a chemical compound with the molecular formula C9H4BrCl2FN2S and a molecular weight of 342.01 g/mol. IUPAC name: 7-bromo-4,6-dichloro-8-fluoro-2-methylsulfanylquinazoline. InChIKey: VQCAZIUXTCXHMZ-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2FN2S |
|---|---|
| Molecular weight | 342.01 g/mol |
| IUPAC name | 7-bromo-4,6-dichloro-8-fluoro-2-methylsulfanylquinazoline |
| InChIKey | VQCAZIUXTCXHMZ-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(C(=C(C=C2C(=N1)Cl)Cl)Br)F |
Computed by PubChem (NCBI)