Products 2757171-08-5

CAS 2757171-08-5 is the registry number for 5-Methoxy-4-methylthiophene-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-methoxy-4-methylthiophene-2-carboxylic acid (CAS 2757171-08-5) is a chemical compound with the molecular formula C7H8O3S and a molecular weight of 172.20 g/mol. IUPAC name: 5-methoxy-4-methylthiophene-2-carboxylic acid. InChIKey: UKGUVYGECSNMQF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8O3S
Molecular weight172.20 g/mol
IUPAC name5-methoxy-4-methylthiophene-2-carboxylic acid
InChIKeyUKGUVYGECSNMQF-UHFFFAOYSA-N
SMILESCC1=C(SC(=C1)C(=O)O)OC

Computed by PubChem (NCBI)