Products 2757188-21-7
CAS 2757188-21-7 is the registry number for Antitumor agent-164. Offered by: MedChemExpress. Available pack sizes: Get quote.
[3-fluoro-6-(3-hydroxy-4-methylphenyl)-2-pyridinyl]-(3,4,5-trimethoxyphenyl)methanone (CAS 2757188-21-7) is a chemical compound with the molecular formula C22H20FNO5 and a molecular weight of 397.4 g/mol. IUPAC name: [3-fluoro-6-(3-hydroxy-4-methylphenyl)-2-pyridinyl]-(3,4,5-trimethoxyphenyl)methanone. InChIKey: JZHPUOFRNWNYQR-UHFFFAOYSA-N.
| Molecular formula | C22H20FNO5 |
|---|---|
| Molecular weight | 397.4 g/mol |
| IUPAC name | [3-fluoro-6-(3-hydroxy-4-methylphenyl)-2-pyridinyl]-(3,4,5-trimethoxyphenyl)methanone |
| InChIKey | JZHPUOFRNWNYQR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NC(=C(C=C2)F)C(=O)C3=CC(=C(C(=C3)OC)OC)OC)O |
Computed by PubChem (NCBI)
Synonyms:
Antitumor agent-164, orb2646116