Products 2757331-07-8
CAS 2757331-07-8 is the registry number for tert-Butyl (3aS,5aS,8aR)-octahydrocyclopenta[2,1-b:5,1-b']dipyrrole-3(3aH)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (1R,5S,8S)-4,9-diazatricyclo[6.3.0.01,5]undecane-4-carboxylate (CAS 2757331-07-8) is a chemical compound with the molecular formula C14H24N2O2 and a molecular weight of 252.35 g/mol. IUPAC name: tert-butyl (1R,5S,8S)-4,9-diazatricyclo[6.3.0.01,5]undecane-4-carboxylate. InChIKey: CBUUYBXZYLSZDW-COPLHBTASA-N.
| Molecular formula | C14H24N2O2 |
|---|---|
| Molecular weight | 252.35 g/mol |
| IUPAC name | tert-butyl (1R,5S,8S)-4,9-diazatricyclo[6.3.0.01,5]undecane-4-carboxylate |
| InChIKey | CBUUYBXZYLSZDW-COPLHBTASA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@]23[C@@H]1CC[C@@H]2NCC3 |
Computed by PubChem (NCBI)